About 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid
5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103261633) has the molecular formula C8H8F3NO3S
and a molecular weight of 255.22 g/mol. Its IUPAC name is 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid |
| PubChem CID | 103261633 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNOCC(F)(F)F)s1 |
| InChI | InChI=1S/C8H8F3NO3S/c9-8(10,11)4-15-12-3-5-1-2-6(16-5)7(13)14/h1-2,12H,3-4H2,(H,13,14) |
| InChIKey | BPUMKBRIRLCWKJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid (CID 103261633) is 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid is O=C(O)c1ccc(CNOCC(F)(F)F)s1.
What is the InChIKey of 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid?
The InChIKey is BPUMKBRIRLCWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO3S/c9-8(10,11)4-15-12-3-5-1-2-6(16-5)7(13)14/h1-2,12H,3-4H2,(H,13,14).
What are the key properties of 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid?
5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid has a molecular weight of 255.22 g/mol, XLogP of 2.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2,2-trifluoroethoxyamino)methyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 103261633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).