About methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate
methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate (PubChem CID 103261636) has the molecular formula C9H14F3NO3
and a molecular weight of 241.21 g/mol. Its IUPAC name is methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate |
| PubChem CID | 103261636 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate |
| SMILES | CCC(=CCNOCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H14F3NO3/c1-3-7(8(14)15-2)4-5-13-16-6-9(10,11)12/h4,13H,3,5-6H2,1-2H3 |
| InChIKey | XUMZQGSUKHXGDG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate (CID 103261636) is methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate is CCC(=CCNOCC(F)(F)F)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate?
The InChIKey is XUMZQGSUKHXGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO3/c1-3-7(8(14)15-2)4-5-13-16-6-9(10,11)12/h4,13H,3,5-6H2,1-2H3.
What are the key properties of methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate?
methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate has a molecular weight of 241.21 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoate is sourced from PubChem (CID 103261636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).