C32H58O6Si2 — CID 10326166
6-[(2S,3S,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-3,7,9-trimethylundeca-5,9-dienyl]-4-methoxypyran-2-one (PubChem CID 10326166) has the molecular formula C32H58O6Si2 and a molecular weight of 594.98 g/mol. Its IUPAC name is 6-[(2S,3S,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-3,7,9-trimethylundeca-5,9-dienyl]-4-methoxypyran-2-one.
| Compound Name | 6-[(2S,3S,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-3,7,9-trimethylundeca-5,9-dienyl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 10326166 |
| Molecular Formula | C32H58O6Si2 |
| Molecular Weight | 594.98 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | 6-[(2S,3S,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-3,7,9-trimethylundeca-5,9-dienyl]-4-methoxypyran-2-one |
| SMILES | C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O)Cc1cc(OC)cc(=O)o1 |
| InChI | InChI=1S/C32H58O6Si2/c1-16-22(2)30(38-40(14,15)32(8,9)10)23(3)17-18-28(37-39(12,13)31(5,6)7)24(4)27(33)20-26-19-25(35-11)21-29(34)36-26/h16-19,21,23-24,27-28,30,33H,20H2,1-15H3/b18-17+,22-16+/t23-,24-,27-,28+,30+/m0/s1 |
| InChIKey | DNZUZYHDWWWWJR-YBZMBCFGSA-N |
| XLogP | 8.13 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.98 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|