C9H16F3N3O3 — CID 103262391
2-[[2-(dimethylcarbamoylamino)ethylamino]methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103262391) has the molecular formula C9H16F3N3O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-[[2-(dimethylcarbamoylamino)ethylamino]methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[[2-(dimethylcarbamoylamino)ethylamino]methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 103262391 |
| Molecular Formula | C9H16F3N3O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[[2-(dimethylcarbamoylamino)ethylamino]methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | CN(C)C(=O)NCCNCC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O3/c1-15(2)8(18)14-4-3-13-5-6(7(16)17)9(10,11)12/h6,13H,3-5H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | AOIUVPUWOLLPFS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|