C12H21NO3 — CID 103262912
4-[(2-hydroxycycloheptyl)amino]-2-methylbut-2-enoic acid (PubChem CID 103262912) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 4-[(2-hydroxycycloheptyl)amino]-2-methylbut-2-enoic acid.
| Compound Name | 4-[(2-hydroxycycloheptyl)amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103262912 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4-[(2-hydroxycycloheptyl)amino]-2-methylbut-2-enoic acid |
| SMILES | CC(=CCNC1CCCCCC1O)C(=O)O |
| InChI | InChI=1S/C12H21NO3/c1-9(12(15)16)7-8-13-10-5-3-2-4-6-11(10)14/h7,10-11,13-14H,2-6,8H2,1H3,(H,15,16) |
| InChIKey | IYDSZMUPIZDTSN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|