C33H48O10 — CID 10326309
2-[(2E,7Z)-7-[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]-2,8-dimethoxynona-2,7-dien-3-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione (PubChem CID 10326309) has the molecular formula C33H48O10 and a molecular weight of 604.74 g/mol. Its IUPAC name is 2-[(2E,7Z)-7-[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]-2,8-dimethoxynona-2,7-dien-3-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione.
| Compound Name | 2-[(2E,7Z)-7-[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]-2,8-dimethoxynona-2,7-dien-3-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 10326309 |
| Molecular Formula | C33H48O10 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | 2-[(2E,7Z)-7-[2,5-dioxo-3,4-di(propan-2-yloxy)cyclopent-3-en-1-yl]-2,8-dimethoxynona-2,7-dien-3-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione |
| SMILES | CO/C(C)=C(/CCC/C(=C(/C)OC)C1C(=O)C(OC(C)C)=C(OC(C)C)C1=O)C1C(=O)C(OC(C)C)=C(OC(C)C)C1=O |
| InChI | InChI=1S/C33H48O10/c1-16(2)40-30-26(34)24(27(35)31(30)41-17(3)4)22(20(9)38-11)14-13-15-23(21(10)39-12)25-28(36)32(42-18(5)6)33(29(25)37)43-19(7)8/h16-19,24-25H,13-15H2,1-12H3/b22-20-,23-21+ |
| InChIKey | RGQYJDLPQLSEDW-KEEJTVGESA-N |
| XLogP | 5.66 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|