C9H14N4O2 — CID 103263473
(Z)-2-methyl-4-[2-(triazol-1-yl)ethylamino]but-2-enoic acid (PubChem CID 103263473) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is (Z)-2-methyl-4-[2-(triazol-1-yl)ethylamino]but-2-enoic acid.
| Compound Name | (Z)-2-methyl-4-[2-(triazol-1-yl)ethylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103263473 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (Z)-2-methyl-4-[2-(triazol-1-yl)ethylamino]but-2-enoic acid |
| SMILES | C/C(=C/CNCCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O2/c1-8(9(14)15)2-3-10-4-6-13-7-5-11-12-13/h2,5,7,10H,3-4,6H2,1H3,(H,14,15)/b8-2- |
| InChIKey | YWRDLWVLUHRQAH-WAPJZHGLSA-N |
| XLogP | -0.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|