C11H21NO3 — CID 103264509
methyl 2-cyclopropyl-2-[(1-methoxy-2-methylpropan-2-yl)amino]acetate (PubChem CID 103264509) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 2-cyclopropyl-2-[(1-methoxy-2-methylpropan-2-yl)amino]acetate.
| Compound Name | methyl 2-cyclopropyl-2-[(1-methoxy-2-methylpropan-2-yl)amino]acetate |
|---|---|
| PubChem CID | 103264509 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl 2-cyclopropyl-2-[(1-methoxy-2-methylpropan-2-yl)amino]acetate |
| SMILES | COCC(C)(C)NC(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C11H21NO3/c1-11(2,7-14-3)12-9(8-5-6-8)10(13)15-4/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | DWRYSKMMHNUOAO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |