C11H18N2O3 — CID 103265508
4-[2-(cyclopropanecarbonylamino)ethylamino]-3-methylbut-2-enoic acid (PubChem CID 103265508) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[2-(cyclopropanecarbonylamino)ethylamino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[2-(cyclopropanecarbonylamino)ethylamino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103265508 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-[2-(cyclopropanecarbonylamino)ethylamino]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCCNC(=O)C1CC1 |
| InChI | InChI=1S/C11H18N2O3/c1-8(6-10(14)15)7-12-4-5-13-11(16)9-2-3-9/h6,9,12H,2-5,7H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | MGCCYFYLELFJBA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|