C11H17N3O2S — CID 103267382
4-[(1-ethylsulfanylpropan-2-ylamino)methyl]pyrimidine-5-carboxylic acid (PubChem CID 103267382) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-[(1-ethylsulfanylpropan-2-ylamino)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(1-ethylsulfanylpropan-2-ylamino)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103267382 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-[(1-ethylsulfanylpropan-2-ylamino)methyl]pyrimidine-5-carboxylic acid |
| SMILES | CCSCC(C)NCc1ncncc1C(=O)O |
| InChI | InChI=1S/C11H17N3O2S/c1-3-17-6-8(2)13-5-10-9(11(15)16)4-12-7-14-10/h4,7-8,13H,3,5-6H2,1-2H3,(H,15,16) |
| InChIKey | BXCAUGLQSIWNBC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |