C15H13BrFNO2 — CID 103267517
2-[(4-bromo-5-fluoro-2-methylanilino)methyl]benzoic acid (PubChem CID 103267517) has the molecular formula C15H13BrFNO2 and a molecular weight of 338.18 g/mol. Its IUPAC name is 2-[(4-bromo-5-fluoro-2-methylanilino)methyl]benzoic acid.
| Compound Name | 2-[(4-bromo-5-fluoro-2-methylanilino)methyl]benzoic acid |
|---|---|
| PubChem CID | 103267517 |
| Molecular Formula | C15H13BrFNO2 |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-[(4-bromo-5-fluoro-2-methylanilino)methyl]benzoic acid |
| SMILES | Cc1cc(Br)c(F)cc1NCc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H13BrFNO2/c1-9-6-12(16)13(17)7-14(9)18-8-10-4-2-3-5-11(10)15(19)20/h2-7,18H,8H2,1H3,(H,19,20) |
| InChIKey | NTCCRCMFPZBVJM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |