C11H13BrFNO3 — CID 103267523
4-(4-bromo-5-fluoro-2-methylanilino)-3-hydroxybutanoic acid (PubChem CID 103267523) has the molecular formula C11H13BrFNO3 and a molecular weight of 306.13 g/mol. Its IUPAC name is 4-(4-bromo-5-fluoro-2-methylanilino)-3-hydroxybutanoic acid.
| Compound Name | 4-(4-bromo-5-fluoro-2-methylanilino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103267523 |
| Molecular Formula | C11H13BrFNO3 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(4-bromo-5-fluoro-2-methylanilino)-3-hydroxybutanoic acid |
| SMILES | Cc1cc(Br)c(F)cc1NCC(O)CC(=O)O |
| InChI | InChI=1S/C11H13BrFNO3/c1-6-2-8(12)9(13)4-10(6)14-5-7(15)3-11(16)17/h2,4,7,14-15H,3,5H2,1H3,(H,16,17) |
| InChIKey | SLRXSXIHHJELTK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |