C15H15BrN2O2 — CID 103267539
(Z)-4-[(3-bromoquinolin-8-yl)amino]-2-ethylbut-2-enoic acid (PubChem CID 103267539) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is (Z)-4-[(3-bromoquinolin-8-yl)amino]-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-[(3-bromoquinolin-8-yl)amino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103267539 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (Z)-4-[(3-bromoquinolin-8-yl)amino]-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/CNc1cccc2cc(Br)cnc12)C(=O)O |
| InChI | InChI=1S/C15H15BrN2O2/c1-2-10(15(19)20)6-7-17-13-5-3-4-11-8-12(16)9-18-14(11)13/h3-6,8-9,17H,2,7H2,1H3,(H,19,20)/b10-6- |
| InChIKey | RMPZAOWJMAXMRL-POHAHGRESA-N |
| XLogP | 3.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|