2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid

C10H14N2O2S — CID 103267938

IUPAC2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid
SMILESCCC(=CCNCc1cncs1)C(=O)O
InChIInChI=1S/C10H14N2O2S/c1-2-8(10(13)14)3-4-11-5-9-6-12-7-15-9/h3,6-7,11H,2,4-5H2,1H3,(H,13,14)
InChIKeyYGCJSJYDHVNPAF-UHFFFAOYSA-N
MW226.30 g/mol
LogP1.65
Rot. Bonds6

About 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid

2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid (PubChem CID 103267938) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid.

Molecular Properties

Compound Name2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid
PubChem CID103267938
Molecular FormulaC10H14N2O2S
Molecular Weight226.30 g/mol
Exact Mass226.08
IUPAC Name2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid
SMILESCCC(=CCNCc1cncs1)C(=O)O
InChIInChI=1S/C10H14N2O2S/c1-2-8(10(13)14)3-4-11-5-9-6-12-7-15-9/h3,6-7,11H,2,4-5H2,1H3,(H,13,14)
InChIKeyYGCJSJYDHVNPAF-UHFFFAOYSA-N
XLogP1.65
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.30
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid?
The IUPAC name of 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid (CID 103267938) is 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid.
What is the SMILES notation for 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid?
The canonical SMILES for 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid is CCC(=CCNCc1cncs1)C(=O)O.
What is the InChIKey of 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid?
The InChIKey is YGCJSJYDHVNPAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-2-8(10(13)14)3-4-11-5-9-6-12-7-15-9/h3,6-7,11H,2,4-5H2,1H3,(H,13,14).
What are the key properties of 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid?
2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid has a molecular weight of 226.30 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid is sourced from PubChem (CID 103267938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).