5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid

C11H16N2O3 — CID 103268286

IUPAC5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid
SMILESCC(NCc1cc(C(=O)O)no1)C1CCC1
InChIInChI=1S/C11H16N2O3/c1-7(8-3-2-4-8)12-6-9-5-10(11(14)15)13-16-9/h5,7-8,12H,2-4,6H2,1H3,(H,14,15)
InChIKeyIKTDXMQMCPFKNP-UHFFFAOYSA-N
MW224.26 g/mol
LogP1.65
Rot. Bonds5

About 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid

5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103268286) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid
PubChem CID103268286
Molecular FormulaC11H16N2O3
Molecular Weight224.26 g/mol
Exact Mass224.12
IUPAC Name5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid
SMILESCC(NCc1cc(C(=O)O)no1)C1CCC1
InChIInChI=1S/C11H16N2O3/c1-7(8-3-2-4-8)12-6-9-5-10(11(14)15)13-16-9/h5,7-8,12H,2-4,6H2,1H3,(H,14,15)
InChIKeyIKTDXMQMCPFKNP-UHFFFAOYSA-N
XLogP1.65
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid (CID 103268286) is 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid is CC(NCc1cc(C(=O)O)no1)C1CCC1.
What is the InChIKey of 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is IKTDXMQMCPFKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-7(8-3-2-4-8)12-6-9-5-10(11(14)15)13-16-9/h5,7-8,12H,2-4,6H2,1H3,(H,14,15).
What are the key properties of 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid?
5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 224.26 g/mol, XLogP of 1.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-cyclobutylethylamino)methyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 103268286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).