C26H32MgN6O8S2 — CID 10326858
magnesium bis([(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylamino]methanesulfonate) (PubChem CID 10326858) has the molecular formula C26H32MgN6O8S2 and a molecular weight of 645.02 g/mol. Its IUPAC name is magnesium bis([(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylamino]methanesulfonate).
| Compound Name | magnesium bis([(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylamino]methanesulfonate) |
|---|---|
| PubChem CID | 10326858 |
| Molecular Formula | C26H32MgN6O8S2 |
| Molecular Weight | 645.02 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | magnesium bis([(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylamino]methanesulfonate) |
| SMILES | Cc1c(N(C)CS(=O)(=O)[O-])c(=O)n(-c2ccccc2)n1C.Cc1c(N(C)CS(=O)(=O)[O-])c(=O)n(-c2ccccc2)n1C.[Mg+2] |
| InChI | InChI=1S/2C13H17N3O4S.Mg/c2*1-10-12(14(2)9-21(18,19)20)13(17)16(15(10)3)11-7-5-4-6-8-11;/h2*4-8H,9H2,1-3H3,(H,18,19,20);/q;;+2/p-2 |
| InChIKey | NHMUJYOBLYTIKO-UHFFFAOYSA-L |
| XLogP | 0.47 |
| TPSA | 174.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.02 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|