C12H19NO2S2 — CID 103268666
5-[(4-ethylsulfanylbutan-2-ylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 103268666) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 5-[(4-ethylsulfanylbutan-2-ylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(4-ethylsulfanylbutan-2-ylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103268666 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-[(4-ethylsulfanylbutan-2-ylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | CCSCCC(C)NCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C12H19NO2S2/c1-3-16-7-6-9(2)13-8-10-4-5-11(17-10)12(14)15/h4-5,9,13H,3,6-8H2,1-2H3,(H,14,15) |
| InChIKey | GAEDYGMPFXQGRZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|