About N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 103269535) has the molecular formula C11H10F3N3O
and a molecular weight of 257.21 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 103269535 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cnc(CNc2ccc(C(F)(F)F)cn2)o1 |
| InChI | InChI=1S/C11H10F3N3O/c1-7-4-17-10(18-7)6-16-9-3-2-8(5-15-9)11(12,13)14/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | BJPZMRSZXWRZPY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine (CID 103269535) is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine is Cc1cnc(CNc2ccc(C(F)(F)F)cn2)o1.
What is the InChIKey of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine?
The InChIKey is BJPZMRSZXWRZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3O/c1-7-4-17-10(18-7)6-16-9-3-2-8(5-15-9)11(12,13)14/h2-5H,6H2,1H3,(H,15,16).
What are the key properties of N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine?
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine has a molecular weight of 257.21 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1,3-oxazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 103269535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).