C14H19BrN2O3 — CID 103269574
1-[(2-bromo-N,5-dimethyl-4-nitroanilino)methyl]cyclopentan-1-ol (PubChem CID 103269574) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[(2-bromo-N,5-dimethyl-4-nitroanilino)methyl]cyclopentan-1-ol.
| Compound Name | 1-[(2-bromo-N,5-dimethyl-4-nitroanilino)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 103269574 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[(2-bromo-N,5-dimethyl-4-nitroanilino)methyl]cyclopentan-1-ol |
| SMILES | Cc1cc(N(C)CC2(O)CCCC2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19BrN2O3/c1-10-7-13(11(15)8-12(10)17(19)20)16(2)9-14(18)5-3-4-6-14/h7-8,18H,3-6,9H2,1-2H3 |
| InChIKey | LWJUPBIXDAVXDA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|