C15H23NO3 — CID 103270829
3-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 103270829) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 3-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 103270829 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | COc1ccc(OC)c(CNCC2CCC(O)C2)c1 |
| InChI | InChI=1S/C15H23NO3/c1-18-14-5-6-15(19-2)12(8-14)10-16-9-11-3-4-13(17)7-11/h5-6,8,11,13,16-17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | FVBLPSHVPOXTNV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |