C35H49N3O8S — CID 10327151
[(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] (2R,4S)-5-[(2S)-4-(1,3-benzodioxol-4-yl)-2-(tert-butylcarbamoyl)piperazin-1-yl]-2-benzyl-4-hydroxypentanoate (PubChem CID 10327151) has the molecular formula C35H49N3O8S and a molecular weight of 671.86 g/mol. Its IUPAC name is [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] (2R,4S)-5-[(2S)-4-(1,3-benzodioxol-4-yl)-2-(tert-butylcarbamoyl)piperazin-1-yl]-2-benzyl-4-hydroxypentanoate.
| Compound Name | [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] (2R,4S)-5-[(2S)-4-(1,3-benzodioxol-4-yl)-2-(tert-butylcarbamoyl)piperazin-1-yl]-2-benzyl-4-hydroxypentanoate |
|---|---|
| PubChem CID | 10327151 |
| Molecular Formula | C35H49N3O8S |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.32 |
| IUPAC Name | [(2R,3R)-1,1-dioxo-2-propan-2-ylthiolan-3-yl] (2R,4S)-5-[(2S)-4-(1,3-benzodioxol-4-yl)-2-(tert-butylcarbamoyl)piperazin-1-yl]-2-benzyl-4-hydroxypentanoate |
| SMILES | CC(C)[C@@H]1[C@H](OC(=O)[C@H](Cc2ccccc2)C[C@H](O)CN2CCN(c3cccc4c3OCO4)C[C@H]2C(=O)NC(C)(C)C)CCS1(=O)=O |
| InChI | InChI=1S/C35H49N3O8S/c1-23(2)32-30(14-17-47(32,42)43)46-34(41)25(18-24-10-7-6-8-11-24)19-26(39)20-37-15-16-38(21-28(37)33(40)36-35(3,4)5)27-12-9-13-29-31(27)45-22-44-29/h6-13,23,25-26,28,30,32,39H,14-22H2,1-5H3,(H,36,40)/t25-,26+,28+,30-,32-/m1/s1 |
| InChIKey | KHVAHLOWLQBJBK-FVAWMTHSSA-N |
| XLogP | 3.19 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |