C14H24N4S — CID 103272301
N'-(2-imidazo[2,1-b][1,3]thiazol-3-ylethyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 103272301) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is N'-(2-imidazo[2,1-b][1,3]thiazol-3-ylethyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(2-imidazo[2,1-b][1,3]thiazol-3-ylethyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103272301 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N'-(2-imidazo[2,1-b][1,3]thiazol-3-ylethyl)-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)CCc1csc2nccn12 |
| InChI | InChI=1S/C14H24N4S/c1-12(2)10-15-5-8-17(3)7-4-13-11-19-14-16-6-9-18(13)14/h6,9,11-12,15H,4-5,7-8,10H2,1-3H3 |
| InChIKey | CJGSJZBBVUATGW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|