C8H11F3O3 — CID 103272470
2-[1-(2,2,2-trifluoroethoxy)cyclobutyl]acetic acid (PubChem CID 103272470) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is 2-[1-(2,2,2-trifluoroethoxy)cyclobutyl]acetic acid.
| Compound Name | 2-[1-(2,2,2-trifluoroethoxy)cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 103272470 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-[1-(2,2,2-trifluoroethoxy)cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(OCC(F)(F)F)CCC1 |
| InChI | InChI=1S/C8H11F3O3/c9-8(10,11)5-14-7(2-1-3-7)4-6(12)13/h1-5H2,(H,12,13) |
| InChIKey | VVCJAFBRVFSTIX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |