C13H14ClFO3 — CID 103272581
methyl 2-[1-(3-chloro-4-fluorophenoxy)cyclobutyl]acetate (PubChem CID 103272581) has the molecular formula C13H14ClFO3 and a molecular weight of 272.70 g/mol. Its IUPAC name is methyl 2-[1-(3-chloro-4-fluorophenoxy)cyclobutyl]acetate.
| Compound Name | methyl 2-[1-(3-chloro-4-fluorophenoxy)cyclobutyl]acetate |
|---|---|
| PubChem CID | 103272581 |
| Molecular Formula | C13H14ClFO3 |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | methyl 2-[1-(3-chloro-4-fluorophenoxy)cyclobutyl]acetate |
| SMILES | COC(=O)CC1(Oc2ccc(F)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C13H14ClFO3/c1-17-12(16)8-13(5-2-6-13)18-9-3-4-11(15)10(14)7-9/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | PFUKFGXDJYQXLR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |