C40H41ClN4O5 — CID 10327323
[3-[(7-chloroquinolin-4-yl)amino]-5-[(2-piperidin-1-ylacetyl)amino]phenyl]methyl 6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoate (PubChem CID 10327323) has the molecular formula C40H41ClN4O5 and a molecular weight of 693.24 g/mol. Its IUPAC name is [3-[(7-chloroquinolin-4-yl)amino]-5-[(2-piperidin-1-ylacetyl)amino]phenyl]methyl 6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoate.
| Compound Name | [3-[(7-chloroquinolin-4-yl)amino]-5-[(2-piperidin-1-ylacetyl)amino]phenyl]methyl 6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoate |
|---|---|
| PubChem CID | 10327323 |
| Molecular Formula | C40H41ClN4O5 |
| Molecular Weight | 693.24 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | [3-[(7-chloroquinolin-4-yl)amino]-5-[(2-piperidin-1-ylacetyl)amino]phenyl]methyl 6-(3-methyl-1,4-dioxonaphthalen-2-yl)hexanoate |
| SMILES | CC1=C(CCCCCC(=O)OCc2cc(NC(=O)CN3CCCCC3)cc(Nc3ccnc4cc(Cl)ccc34)c2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C40H41ClN4O5/c1-26-31(40(49)33-12-7-6-11-32(33)39(26)48)10-4-2-5-13-38(47)50-25-27-20-29(43-35-16-17-42-36-22-28(41)14-15-34(35)36)23-30(21-27)44-37(46)24-45-18-8-3-9-19-45/h6-7,11-12,14-17,20-23H,2-5,8-10,13,18-19,24-25H2,1H3,(H,42,43)(H,44,46) |
| InChIKey | JUPUAJFKGWMQKY-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.24 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|