C14H20INO — CID 103273839
N-ethyl-2-[1-(3-iodophenoxy)cyclobutyl]ethanamine (PubChem CID 103273839) has the molecular formula C14H20INO and a molecular weight of 345.22 g/mol. Its IUPAC name is N-ethyl-2-[1-(3-iodophenoxy)cyclobutyl]ethanamine.
| Compound Name | N-ethyl-2-[1-(3-iodophenoxy)cyclobutyl]ethanamine |
|---|---|
| PubChem CID | 103273839 |
| Molecular Formula | C14H20INO |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-ethyl-2-[1-(3-iodophenoxy)cyclobutyl]ethanamine |
| SMILES | CCNCCC1(Oc2cccc(I)c2)CCC1 |
| InChI | InChI=1S/C14H20INO/c1-2-16-10-9-14(7-4-8-14)17-13-6-3-5-12(15)11-13/h3,5-6,11,16H,2,4,7-10H2,1H3 |
| InChIKey | LFSLAJYULZEGNK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|