C12H22F3NO — CID 103274392
N-[2-[1-(3,3,3-trifluoropropoxy)cyclobutyl]ethyl]propan-1-amine (PubChem CID 103274392) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is N-[2-[1-(3,3,3-trifluoropropoxy)cyclobutyl]ethyl]propan-1-amine.
| Compound Name | N-[2-[1-(3,3,3-trifluoropropoxy)cyclobutyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103274392 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-[2-[1-(3,3,3-trifluoropropoxy)cyclobutyl]ethyl]propan-1-amine |
| SMILES | CCCNCCC1(OCCC(F)(F)F)CCC1 |
| InChI | InChI=1S/C12H22F3NO/c1-2-8-16-9-6-11(4-3-5-11)17-10-7-12(13,14)15/h16H,2-10H2,1H3 |
| InChIKey | CURAWLNRQWBGQC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|