C15H22BrNO2 — CID 103274844
3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-2-methylbenzamide (PubChem CID 103274844) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-2-methylbenzamide.
| Compound Name | 3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 103274844 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-bromo-N-(1-ethoxy-3-methylbutan-2-yl)-2-methylbenzamide |
| SMILES | CCOCC(NC(=O)c1cccc(Br)c1C)C(C)C |
| InChI | InChI=1S/C15H22BrNO2/c1-5-19-9-14(10(2)3)17-15(18)12-7-6-8-13(16)11(12)4/h6-8,10,14H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | HEVDVPXGZFVFNK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |