C42H72O9 — CID 10327543
(4E,18E)-7,9,11-trihydroxy-6'-(2-hydroxybutyl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione (PubChem CID 10327543) has the molecular formula C42H72O9 and a molecular weight of 721.03 g/mol. Its IUPAC name is (4E,18E)-7,9,11-trihydroxy-6'-(2-hydroxybutyl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione.
| Compound Name | (4E,18E)-7,9,11-trihydroxy-6'-(2-hydroxybutyl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione |
|---|---|
| PubChem CID | 10327543 |
| Molecular Formula | C42H72O9 |
| Molecular Weight | 721.03 g/mol |
| Exact Mass | 720.52 |
| IUPAC Name | (4E,18E)-7,9,11-trihydroxy-6'-(2-hydroxybutyl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione |
| SMILES | CCC(O)CC1OC2(CCC1C)CC1OC(=O)/C=C/C(C)C(O)C(C)C(O)CC(O)C(C)CCCCC/C=C/C(CC(C)C)C(=O)CC(O2)C1C |
| InChI | InChI=1S/C42H72O9/c1-9-33(43)22-37-28(5)19-20-42(50-37)25-39-31(8)38(51-42)24-36(46)32(21-26(2)3)16-14-12-10-11-13-15-27(4)34(44)23-35(45)30(7)41(48)29(6)17-18-40(47)49-39/h14,16-18,26-35,37-39,41,43-45,48H,9-13,15,19-25H2,1-8H3/b16-14+,18-17+ |
| InChIKey | VARNFPKZDRZDKD-ZCXPIULRSA-N |
| XLogP | 7.07 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.03 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|