C11H18F3N — CID 103275921
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 103275921) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 103275921 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | CC1=CC(C)CC(CNCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H18F3N/c1-8-3-9(2)5-10(4-8)6-15-7-11(12,13)14/h3,8,10,15H,4-7H2,1-2H3 |
| InChIKey | LTRDURBKMQXGTL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|