C15H18BrCl2N — CID 103276167
4-bromo-2,6-dichloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline (PubChem CID 103276167) has the molecular formula C15H18BrCl2N and a molecular weight of 363.13 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 103276167 |
| Molecular Formula | C15H18BrCl2N |
| Molecular Weight | 363.13 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]aniline |
| SMILES | CC1=CC(C)CC(CNc2c(Cl)cc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C15H18BrCl2N/c1-9-3-10(2)5-11(4-9)8-19-15-13(17)6-12(16)7-14(15)18/h3,6-7,9,11,19H,4-5,8H2,1-2H3 |
| InChIKey | KBDIFIZZPDYWMW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.13 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|