C17H23F2N — CID 103276257
1-(2,4-difluorophenyl)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]ethanamine (PubChem CID 103276257) has the molecular formula C17H23F2N and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]ethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103276257 |
| Molecular Formula | C17H23F2N |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]ethanamine |
| SMILES | CC1=CC(C)CC(CNC(C)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H23F2N/c1-11-6-12(2)8-14(7-11)10-20-13(3)16-5-4-15(18)9-17(16)19/h4-6,9,11,13-14,20H,7-8,10H2,1-3H3 |
| InChIKey | UMBWPHZSKAICAO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|