C17H22N4 — CID 103276314
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(1,2,4-triazol-4-yl)aniline (PubChem CID 103276314) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(1,2,4-triazol-4-yl)aniline.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(1,2,4-triazol-4-yl)aniline |
|---|---|
| PubChem CID | 103276314 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-3-(1,2,4-triazol-4-yl)aniline |
| SMILES | CC1=CC(C)CC(CNc2cccc(-n3cnnc3)c2)C1 |
| InChI | InChI=1S/C17H22N4/c1-13-6-14(2)8-15(7-13)10-18-16-4-3-5-17(9-16)21-11-19-20-12-21/h3-6,9,11-13,15,18H,7-8,10H2,1-2H3 |
| InChIKey | FKNDMLFGUCLTHC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|