C11H19N5 — CID 103276703
1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine (PubChem CID 103276703) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 103276703 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(2H-tetrazol-5-ylmethyl)methanamine |
| SMILES | CC1=CC(C)CC(CNCc2nn[nH]n2)C1 |
| InChI | InChI=1S/C11H19N5/c1-8-3-9(2)5-10(4-8)6-12-7-11-13-15-16-14-11/h3,8,10,12H,4-7H2,1-2H3,(H,13,14,15,16) |
| InChIKey | UDLSMULYZNBWGH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|