About 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol
4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol (PubChem CID 103276919) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol |
| PubChem CID | 103276919 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol |
| SMILES | CC1=CC(C)CC(CNCC2(O)CCOCC2)C1 |
| InChI | InChI=1S/C15H27NO2/c1-12-7-13(2)9-14(8-12)10-16-11-15(17)3-5-18-6-4-15/h7,12,14,16-17H,3-6,8-11H2,1-2H3 |
| InChIKey | YGMPIOLCLMYTCR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol (CID 103276919) is 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol is CC1=CC(C)CC(CNCC2(O)CCOCC2)C1.
What is the InChIKey of 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol?
The InChIKey is YGMPIOLCLMYTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-12-7-13(2)9-14(8-12)10-16-11-15(17)3-5-18-6-4-15/h7,12,14,16-17H,3-6,8-11H2,1-2H3.
What are the key properties of 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol?
4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol has a molecular weight of 253.39 g/mol, XLogP of 2.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]methyl]oxan-4-ol is sourced from PubChem (CID 103276919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).