About N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine (PubChem CID 103277017) has the molecular formula C18H33NO
and a molecular weight of 279.47 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine |
| PubChem CID | 103277017 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine |
| SMILES | CCC1(CC)CC(NCC2CC(C)=CC(C)C2)CCO1 |
| InChI | InChI=1S/C18H33NO/c1-5-18(6-2)12-17(7-8-20-18)19-13-16-10-14(3)9-15(4)11-16/h9,14,16-17,19H,5-8,10-13H2,1-4H3 |
| InChIKey | ZYFIWBFZICIIPN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine?
The IUPAC name of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine (CID 103277017) is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine.
What is the SMILES notation for N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine?
The canonical SMILES for N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine is CCC1(CC)CC(NCC2CC(C)=CC(C)C2)CCO1.
What is the InChIKey of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine?
The InChIKey is ZYFIWBFZICIIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO/c1-5-18(6-2)12-17(7-8-20-18)19-13-16-10-14(3)9-15(4)11-16/h9,14,16-17,19H,5-8,10-13H2,1-4H3.
What are the key properties of N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine?
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine has a molecular weight of 279.47 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2,2-diethyloxan-4-amine is sourced from PubChem (CID 103277017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).