C34H39Cl2N4O7PS — CID 10327724
ethyl (2S)-2-[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]oxypropanoate (PubChem CID 10327724) has the molecular formula C34H39Cl2N4O7PS and a molecular weight of 749.65 g/mol. Its IUPAC name is ethyl (2S)-2-[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]oxypropanoate.
| Compound Name | ethyl (2S)-2-[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 10327724 |
| Molecular Formula | C34H39Cl2N4O7PS |
| Molecular Weight | 749.65 g/mol |
| Exact Mass | 748.17 |
| IUPAC Name | ethyl (2S)-2-[3-[[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methoxycarbonylamino]propyl-phenoxyphosphoryl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](C)OP(=O)(CCCNC(=O)OCc1nc(C(C)C)c(Sc2cc(Cl)cc(Cl)c2)n1Cc1ccncc1)Oc1ccccc1 |
| InChI | InChI=1S/C34H39Cl2N4O7PS/c1-5-44-33(41)24(4)46-48(43,47-28-10-7-6-8-11-28)17-9-14-38-34(42)45-22-30-39-31(23(2)3)32(40(30)21-25-12-15-37-16-13-25)49-29-19-26(35)18-27(36)20-29/h6-8,10-13,15-16,18-20,23-24H,5,9,14,17,21-22H2,1-4H3,(H,38,42)/t24-,48?/m0/s1 |
| InChIKey | CRQXGWLQIFMTAK-QXMUVGSWSA-N |
| XLogP | 8.76 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.65 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|