C14H22F3NO2 — CID 103277328
ethyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 103277328) has the molecular formula C14H22F3NO2 and a molecular weight of 293.33 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | ethyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 103277328 |
| Molecular Formula | C14H22F3NO2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 2-(3,5-dimethylcyclohex-3-en-1-yl)-2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | CCOC(=O)C(NCC(F)(F)F)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C14H22F3NO2/c1-4-20-13(19)12(18-8-14(15,16)17)11-6-9(2)5-10(3)7-11/h5,9,11-12,18H,4,6-8H2,1-3H3 |
| InChIKey | STYQUCIXIHQSLI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|