C43H78O10 — CID 10327756
(2S)-4-[(2R,13R)-2,13-bis(methoxymethoxy)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one (PubChem CID 10327756) has the molecular formula C43H78O10 and a molecular weight of 755.09 g/mol. Its IUPAC name is (2S)-4-[(2R,13R)-2,13-bis(methoxymethoxy)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(2R,13R)-2,13-bis(methoxymethoxy)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10327756 |
| Molecular Formula | C43H78O10 |
| Molecular Weight | 755.09 g/mol |
| Exact Mass | 754.56 |
| IUPAC Name | (2S)-4-[(2R,13R)-2,13-bis(methoxymethoxy)-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCCCC[C@H](OCOC)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCCCCCC[C@H](CC3=C[C@H](C)OC3=O)OCOC)OCOC)O2)O1 |
| InChI | InChI=1S/C43H78O10/c1-6-7-8-9-10-14-17-20-23-37(49-32-46-4)39-25-27-41(52-39)42-28-26-40(53-42)38(50-33-47-5)24-21-18-15-12-11-13-16-19-22-36(48-31-45-3)30-35-29-34(2)51-43(35)44/h29,34,36-42H,6-28,30-33H2,1-5H3/t34-,36+,37-,38+,39+,40+,41+,42+/m0/s1 |
| InChIKey | PQEMMDRJFXPDJM-RUIGJDMPSA-N |
| XLogP | 9.74 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.09 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|