C14H25NO3S — CID 103277876
[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol (PubChem CID 103277876) has the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. Its IUPAC name is [3-(aminomethyl)-1,1-dioxothiolan-3-yl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol.
| Compound Name | [3-(aminomethyl)-1,1-dioxothiolan-3-yl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
|---|---|
| PubChem CID | 103277876 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [3-(aminomethyl)-1,1-dioxothiolan-3-yl]-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
| SMILES | CC1=CC(C)CC(C(O)C2(CN)CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C14H25NO3S/c1-10-5-11(2)7-12(6-10)13(16)14(8-15)3-4-19(17,18)9-14/h5,10,12-13,16H,3-4,6-9,15H2,1-2H3 |
| InChIKey | GVFWBWNFKVTADP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|