C17H22FN3 — CID 103277947
5-(3,5-dimethylcyclohex-3-en-1-yl)-1-(2-fluorophenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 103277947) has the molecular formula C17H22FN3 and a molecular weight of 287.38 g/mol. Its IUPAC name is 5-(3,5-dimethylcyclohex-3-en-1-yl)-1-(2-fluorophenyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-(3,5-dimethylcyclohex-3-en-1-yl)-1-(2-fluorophenyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 103277947 |
| Molecular Formula | C17H22FN3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 5-(3,5-dimethylcyclohex-3-en-1-yl)-1-(2-fluorophenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | CC1=CC(C)CC(C2CN=C(N)N2c2ccccc2F)C1 |
| InChI | InChI=1S/C17H22FN3/c1-11-7-12(2)9-13(8-11)16-10-20-17(19)21(16)15-6-4-3-5-14(15)18/h3-7,11,13,16H,8-10H2,1-2H3,(H2,19,20) |
| InChIKey | FBPTVFFUJWODNS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|