C12H12BrF3N2O2 — CID 103278143
N-(2-amino-2-oxoethyl)-4-bromo-N-ethyl-2-(trifluoromethyl)benzamide (PubChem CID 103278143) has the molecular formula C12H12BrF3N2O2 and a molecular weight of 353.14 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-bromo-N-ethyl-2-(trifluoromethyl)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-bromo-N-ethyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103278143 |
| Molecular Formula | C12H12BrF3N2O2 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-bromo-N-ethyl-2-(trifluoromethyl)benzamide |
| SMILES | CCN(CC(N)=O)C(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3N2O2/c1-2-18(6-10(17)19)11(20)8-4-3-7(13)5-9(8)12(14,15)16/h3-5H,2,6H2,1H3,(H2,17,19) |
| InChIKey | YVNDKILALQHCFU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |