About 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine
1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine (PubChem CID 103278561) has the molecular formula C16H18N4O
and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine |
| PubChem CID | 103278561 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine |
| SMILES | NC1CCN(c2ncc3c(n2)-c2ccccc2OC3)CC1 |
| InChI | InChI=1S/C16H18N4O/c17-12-5-7-20(8-6-12)16-18-9-11-10-21-14-4-2-1-3-13(14)15(11)19-16/h1-4,9,12H,5-8,10,17H2 |
| InChIKey | NFVBSXMNBWBNMF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine?
The IUPAC name of 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine (CID 103278561) is 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine.
What is the SMILES notation for 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine?
The canonical SMILES for 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine is NC1CCN(c2ncc3c(n2)-c2ccccc2OC3)CC1.
What is the InChIKey of 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine?
The InChIKey is NFVBSXMNBWBNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O/c17-12-5-7-20(8-6-12)16-18-9-11-10-21-14-4-2-1-3-13(14)15(11)19-16/h1-4,9,12H,5-8,10,17H2.
What are the key properties of 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine?
1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine has a molecular weight of 282.35 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5H-chromeno[4,3-d]pyrimidin-2-yl)piperidin-4-amine is sourced from PubChem (CID 103278561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).