C16H19FN4 — CID 103278804
[1-[4-(4-fluorophenyl)pyrimidin-2-yl]piperidin-3-yl]methanamine (PubChem CID 103278804) has the molecular formula C16H19FN4 and a molecular weight of 286.35 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)pyrimidin-2-yl]piperidin-3-yl]methanamine.
| Compound Name | [1-[4-(4-fluorophenyl)pyrimidin-2-yl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 103278804 |
| Molecular Formula | C16H19FN4 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [1-[4-(4-fluorophenyl)pyrimidin-2-yl]piperidin-3-yl]methanamine |
| SMILES | NCC1CCCN(c2nccc(-c3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C16H19FN4/c17-14-5-3-13(4-6-14)15-7-8-19-16(20-15)21-9-1-2-12(10-18)11-21/h3-8,12H,1-2,9-11,18H2 |
| InChIKey | QIYFLNMJGNKJMV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |