About N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine
N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 103278875) has the molecular formula C14H14N4O
and a molecular weight of 254.29 g/mol. Its IUPAC name is N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
| PubChem CID | 103278875 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | NCCNc1nccc(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C14H14N4O/c15-6-8-17-14-16-7-5-11(18-14)13-9-10-3-1-2-4-12(10)19-13/h1-5,7,9H,6,8,15H2,(H,16,17,18) |
| InChIKey | GUAFZROFJZUJEI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine?
The IUPAC name of N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine (CID 103278875) is N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine is NCCNc1nccc(-c2cc3ccccc3o2)n1.
What is the InChIKey of N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine?
The InChIKey is GUAFZROFJZUJEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O/c15-6-8-17-14-16-7-5-11(18-14)13-9-10-3-1-2-4-12(10)19-13/h1-5,7,9H,6,8,15H2,(H,16,17,18).
What are the key properties of N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine?
N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine has a molecular weight of 254.29 g/mol, XLogP of 2.26, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 103278875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).