C14H14N4O — CID 103278875
N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 103278875) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103278875 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N'-[4-(1-benzofuran-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | NCCNc1nccc(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C14H14N4O/c15-6-8-17-14-16-7-5-11(18-14)13-9-10-3-1-2-4-12(10)19-13/h1-5,7,9H,6,8,15H2,(H,16,17,18) |
| InChIKey | GUAFZROFJZUJEI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |