About N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine
N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 103279487) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 103279487 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)c1nccc(C(C)(C)C)n1 |
| InChI | InChI=1S/C11H20N4/c1-11(2,3)9-5-7-13-10(14-9)15(4)8-6-12/h5,7H,6,8,12H2,1-4H3 |
| InChIKey | JRMYRPCVXKAEEM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine (CID 103279487) is N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine is CN(CCN)c1nccc(C(C)(C)C)n1.
What is the InChIKey of N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is JRMYRPCVXKAEEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-11(2,3)9-5-7-13-10(14-9)15(4)8-6-12/h5,7H,6,8,12H2,1-4H3.
What are the key properties of N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 208.31 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-tert-butylpyrimidin-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 103279487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).