About N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine
N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine (PubChem CID 103279515) has the molecular formula C14H22N6
and a molecular weight of 274.37 g/mol. Its IUPAC name is N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine |
| PubChem CID | 103279515 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine |
| SMILES | CCn1nc(C)c(-c2ccnc(N(C)CCN)n2)c1C |
| InChI | InChI=1S/C14H22N6/c1-5-20-11(3)13(10(2)18-20)12-6-8-16-14(17-12)19(4)9-7-15/h6,8H,5,7,9,15H2,1-4H3 |
| InChIKey | ZIPITAWKYJRXNG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine?
The IUPAC name of N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine (CID 103279515) is N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine is CCn1nc(C)c(-c2ccnc(N(C)CCN)n2)c1C.
What is the InChIKey of N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine?
The InChIKey is ZIPITAWKYJRXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6/c1-5-20-11(3)13(10(2)18-20)12-6-8-16-14(17-12)19(4)9-7-15/h6,8H,5,7,9,15H2,1-4H3.
What are the key properties of N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine?
N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine has a molecular weight of 274.37 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(1-ethyl-3,5-dimethylpyrazol-4-yl)pyrimidin-2-yl]-N'-methylethane-1,2-diamine is sourced from PubChem (CID 103279515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).