C40H36N4O6S2Zn — CID 10327984
zinc 5,15-bis[4-(3-methylsulfonylpropoxy)phenyl]porphyrin-21,22-diide (PubChem CID 10327984) has the molecular formula C40H36N4O6S2Zn and a molecular weight of 798.27 g/mol. Its IUPAC name is zinc 5,15-bis[4-(3-methylsulfonylpropoxy)phenyl]porphyrin-21,22-diide.
| Compound Name | zinc 5,15-bis[4-(3-methylsulfonylpropoxy)phenyl]porphyrin-21,22-diide |
|---|---|
| PubChem CID | 10327984 |
| Molecular Formula | C40H36N4O6S2Zn |
| Molecular Weight | 798.27 g/mol |
| Exact Mass | 796.14 |
| IUPAC Name | zinc 5,15-bis[4-(3-methylsulfonylpropoxy)phenyl]porphyrin-21,22-diide |
| SMILES | CS(=O)(=O)CCCOc1ccc(-c2c3nc(cc4ccc([n-]4)c(-c4ccc(OCCCS(C)(=O)=O)cc4)c4ccc(cc5nc2C=C5)[n-]4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C40H36N4O6S2.Zn/c1-51(45,46)23-3-21-49-33-13-5-27(6-14-33)39-35-17-9-29(41-35)25-31-11-19-37(43-31)40(38-20-12-32(44-38)26-30-10-18-36(39)42-30)28-7-15-34(16-8-28)50-22-4-24-52(2,47)48;/h5-20,25-26H,3-4,21-24H2,1-2H3;/q-2;+2/b29-25-,30-26-,31-25-,32-26-,39-35-,39-36-,40-37-,40-38-; |
| InChIKey | JATMPLLKXMPJIU-NEBHXPRCSA-N |
| XLogP | 6.87 |
| TPSA | 140.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.27 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|