C12H23NO2 — CID 103279887
N-[(3-hydroxycyclopentyl)methyl]-3,3-dimethylbutanamide (PubChem CID 103279887) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(3-hydroxycyclopentyl)methyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(3-hydroxycyclopentyl)methyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103279887 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[(3-hydroxycyclopentyl)methyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCC1CCC(O)C1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2,3)7-11(15)13-8-9-4-5-10(14)6-9/h9-10,14H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | GCPBIDREAANCPW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |