C8H13F2N3 — CID 103281655
5-(difluoromethyl)-2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine (PubChem CID 103281655) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 5-(difluoromethyl)-2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine.
| Compound Name | 5-(difluoromethyl)-2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 103281655 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 5-(difluoromethyl)-2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine |
| SMILES | CC1CN2C(=NCCC2C(F)F)N1 |
| InChI | InChI=1S/C8H13F2N3/c1-5-4-13-6(7(9)10)2-3-11-8(13)12-5/h5-7H,2-4H2,1H3,(H,11,12) |
| InChIKey | KMQROARSMITPDM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |